C15H19BrO9 — CID 101202873
[(2R)-2-acetyloxy-2-[(2R,3S,4R,5Z)-3,4-diacetyloxy-5-(bromomethylidene)oxolan-2-yl]ethyl] acetate (PubChem CID 101202873) has the molecular formula C15H19BrO9 and a molecular weight of 423.21 g/mol. Its IUPAC name is [(2R)-2-acetyloxy-2-[(2R,3S,4R,5Z)-3,4-diacetyloxy-5-(bromomethylidene)oxolan-2-yl]ethyl] acetate.
| Compound Name | [(2R)-2-acetyloxy-2-[(2R,3S,4R,5Z)-3,4-diacetyloxy-5-(bromomethylidene)oxolan-2-yl]ethyl] acetate |
|---|---|
| PubChem CID | 101202873 |
| Molecular Formula | C15H19BrO9 |
| Molecular Weight | 423.21 g/mol |
| Exact Mass | 422.02 |
| IUPAC Name | [(2R)-2-acetyloxy-2-[(2R,3S,4R,5Z)-3,4-diacetyloxy-5-(bromomethylidene)oxolan-2-yl]ethyl] acetate |
| SMILES | CC(=O)OC[C@@H](OC(C)=O)[C@H]1O/C(=C\Br)[C@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C15H19BrO9/c1-7(17)21-6-12(22-8(2)18)14-15(24-10(4)20)13(23-9(3)19)11(5-16)25-14/h5,12-15H,6H2,1-4H3/b11-5-/t12-,13+,14-,15-/m1/s1 |
| InChIKey | BSGUBEDCMTVSFH-YVEPKNASSA-N |
| XLogP | 0.98 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.21 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|