C22H24O10 — CID 101202874
[(2R)-2-acetyloxy-2-[(2R,3S,4R,5Z)-3,4-diacetyloxy-5-[(4-formylphenyl)methylidene]oxolan-2-yl]ethyl] acetate (PubChem CID 101202874) has the molecular formula C22H24O10 and a molecular weight of 448.42 g/mol. Its IUPAC name is [(2R)-2-acetyloxy-2-[(2R,3S,4R,5Z)-3,4-diacetyloxy-5-[(4-formylphenyl)methylidene]oxolan-2-yl]ethyl] acetate.
| Compound Name | [(2R)-2-acetyloxy-2-[(2R,3S,4R,5Z)-3,4-diacetyloxy-5-[(4-formylphenyl)methylidene]oxolan-2-yl]ethyl] acetate |
|---|---|
| PubChem CID | 101202874 |
| Molecular Formula | C22H24O10 |
| Molecular Weight | 448.42 g/mol |
| Exact Mass | 448.14 |
| IUPAC Name | [(2R)-2-acetyloxy-2-[(2R,3S,4R,5Z)-3,4-diacetyloxy-5-[(4-formylphenyl)methylidene]oxolan-2-yl]ethyl] acetate |
| SMILES | CC(=O)OC[C@@H](OC(C)=O)[C@H]1O/C(=C\c2ccc(C=O)cc2)[C@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C22H24O10/c1-12(24)28-11-19(29-13(2)25)21-22(31-15(4)27)20(30-14(3)26)18(32-21)9-16-5-7-17(10-23)8-6-16/h5-10,19-22H,11H2,1-4H3/b18-9-/t19-,20+,21-,22-/m1/s1 |
| InChIKey | MABCZBNHUDBGLU-ZLQHYCCLSA-N |
| XLogP | 1.60 |
| TPSA | 131.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.42 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|