C21H24O8 — CID 11258205
[(2R,3S,4R,5E)-4-acetyloxy-2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-5-[(4-formylphenyl)methylidene]oxolan-3-yl] acetate (PubChem CID 11258205) has the molecular formula C21H24O8 and a molecular weight of 404.42 g/mol. Its IUPAC name is [(2R,3S,4R,5E)-4-acetyloxy-2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-5-[(4-formylphenyl)methylidene]oxolan-3-yl] acetate.
| Compound Name | [(2R,3S,4R,5E)-4-acetyloxy-2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-5-[(4-formylphenyl)methylidene]oxolan-3-yl] acetate |
|---|---|
| PubChem CID | 11258205 |
| Molecular Formula | C21H24O8 |
| Molecular Weight | 404.42 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | [(2R,3S,4R,5E)-4-acetyloxy-2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-5-[(4-formylphenyl)methylidene]oxolan-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1[C@@H]([C@H]2COC(C)(C)O2)O/C(=C/c2ccc(C=O)cc2)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C21H24O8/c1-12(23)26-18-16(9-14-5-7-15(10-22)8-6-14)28-19(20(18)27-13(2)24)17-11-25-21(3,4)29-17/h5-10,17-20H,11H2,1-4H3/b16-9+/t17-,18+,19-,20-/m1/s1 |
| InChIKey | OJWBFDUZPDZPCO-JNPZIMGWSA-N |
| XLogP | 2.25 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.42 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|