C9H14O5 — CID 153312743
[(4S,6aS)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl] acetate (PubChem CID 153312743) has the molecular formula C9H14O5 and a molecular weight of 202.21 g/mol. Its IUPAC name is [(4S,6aS)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl] acetate.
| Compound Name | [(4S,6aS)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl] acetate |
|---|---|
| PubChem CID | 153312743 |
| Molecular Formula | C9H14O5 |
| Molecular Weight | 202.21 g/mol |
| Exact Mass | 202.08 |
| IUPAC Name | [(4S,6aS)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl] acetate |
| SMILES | CC(=O)O[C@@H]1OC[C@@H]2OC(C)(C)OC12 |
| InChI | InChI=1S/C9H14O5/c1-5(10)12-8-7-6(4-11-8)13-9(2,3)14-7/h6-8H,4H2,1-3H3/t6-,7?,8-/m0/s1 |
| InChIKey | GFCSYKYRSODEGC-PPSBICQBSA-N |
| XLogP | 0.43 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.21 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |