C12H19NO8 — CID 100975903
[(3aR,6R,7S,7aR)-6-methoxy-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl] 2-nitropropanoate (PubChem CID 100975903) has the molecular formula C12H19NO8 and a molecular weight of 305.28 g/mol. Its IUPAC name is [(3aR,6R,7S,7aR)-6-methoxy-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl] 2-nitropropanoate.
| Compound Name | [(3aR,6R,7S,7aR)-6-methoxy-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl] 2-nitropropanoate |
|---|---|
| PubChem CID | 100975903 |
| Molecular Formula | C12H19NO8 |
| Molecular Weight | 305.28 g/mol |
| Exact Mass | 305.11 |
| IUPAC Name | [(3aR,6R,7S,7aR)-6-methoxy-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl] 2-nitropropanoate |
| SMILES | CO[C@@H]1OC[C@H]2OC(C)(C)O[C@H]2[C@@H]1OC(=O)C(C)[N+](=O)[O-] |
| InChI | InChI=1S/C12H19NO8/c1-6(13(15)16)10(14)19-9-8-7(5-18-11(9)17-4)20-12(2,3)21-8/h6-9,11H,5H2,1-4H3/t6?,7-,8-,9+,11-/m1/s1 |
| InChIKey | QBBMLOHPEPCCNO-SACKOADKSA-N |
| XLogP | 0.09 |
| TPSA | 106.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.28 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|