C11H18O5S2 — CID 14336490
O-[(3aS,6S,7R,7aR)-6-methoxy-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl] methylsulfanylmethanethioate (PubChem CID 14336490) has the molecular formula C11H18O5S2 and a molecular weight of 294.39 g/mol. Its IUPAC name is O-[(3aS,6S,7R,7aR)-6-methoxy-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl] methylsulfanylmethanethioate.
| Compound Name | O-[(3aS,6S,7R,7aR)-6-methoxy-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl] methylsulfanylmethanethioate |
|---|---|
| PubChem CID | 14336490 |
| Molecular Formula | C11H18O5S2 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.06 |
| IUPAC Name | O-[(3aS,6S,7R,7aR)-6-methoxy-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl] methylsulfanylmethanethioate |
| SMILES | CO[C@H]1OC[C@@H]2OC(C)(C)O[C@H]2[C@H]1OC(=S)SC |
| InChI | InChI=1S/C11H18O5S2/c1-11(2)15-6-5-13-9(12-3)8(7(6)16-11)14-10(17)18-4/h6-9H,5H2,1-4H3/t6-,7+,8+,9-/m0/s1 |
| InChIKey | DSOIYSHTYHMDGW-KDXUFGMBSA-N |
| XLogP | 1.54 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|