C23H36O13 — CID 59022348
[(3R,4S,5R,6R)-4,5-diacetyloxy-6-[(2R)-2-[(4R,5R)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-hydroxyethoxy]oxan-3-yl] acetate (PubChem CID 59022348) has the molecular formula C23H36O13 and a molecular weight of 520.53 g/mol. Its IUPAC name is [(3R,4S,5R,6R)-4,5-diacetyloxy-6-[(2R)-2-[(4R,5R)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-hydroxyethoxy]oxan-3-yl] acetate.
| Compound Name | [(3R,4S,5R,6R)-4,5-diacetyloxy-6-[(2R)-2-[(4R,5R)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-hydroxyethoxy]oxan-3-yl] acetate |
|---|---|
| PubChem CID | 59022348 |
| Molecular Formula | C23H36O13 |
| Molecular Weight | 520.53 g/mol |
| Exact Mass | 520.22 |
| IUPAC Name | [(3R,4S,5R,6R)-4,5-diacetyloxy-6-[(2R)-2-[(4R,5R)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-hydroxyethoxy]oxan-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@@H](OC(C)=O)[C@H](OC[C@@H](O)[C@H]2OC(C)(C)O[C@@H]2[C@H]2COC(C)(C)O2)OC[C@H]1OC(C)=O |
| InChI | InChI=1S/C23H36O13/c1-11(24)31-15-9-29-21(20(33-13(3)26)18(15)32-12(2)25)28-8-14(27)17-19(36-23(6,7)35-17)16-10-30-22(4,5)34-16/h14-21,27H,8-10H2,1-7H3/t14-,15-,16-,17-,18+,19-,20-,21-/m1/s1 |
| InChIKey | XUYRWEJEWJTLNF-BPASCOCISA-N |
| XLogP | 0.19 |
| TPSA | 154.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.53 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|