C12H21NO7 — CID 73334090
1-[(4R,5R)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-nitroethanol (PubChem CID 73334090) has the molecular formula C12H21NO7 and a molecular weight of 291.30 g/mol. Its IUPAC name is 1-[(4R,5R)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-nitroethanol.
| Compound Name | 1-[(4R,5R)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-nitroethanol |
|---|---|
| PubChem CID | 73334090 |
| Molecular Formula | C12H21NO7 |
| Molecular Weight | 291.30 g/mol |
| Exact Mass | 291.13 |
| IUPAC Name | 1-[(4R,5R)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-nitroethanol |
| SMILES | CC1(C)O[C@H]([C@H]2COC(C)(C)O2)[C@@H](C(O)C[N+](=O)[O-])O1 |
| InChI | InChI=1S/C12H21NO7/c1-11(2)17-6-8(18-11)10-9(7(14)5-13(15)16)19-12(3,4)20-10/h7-10,14H,5-6H2,1-4H3/t7?,8-,9-,10-/m1/s1 |
| InChIKey | ZPHALKGJRPRCQT-NPTNVHDASA-N |
| XLogP | 0.30 |
| TPSA | 100.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.30 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|