C16H30N2O7S — CID 132516912
N-[(1R)-1-[(4R,5S)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-nitroethyl]-2-methylpropane-2-sulfinamide (PubChem CID 132516912) has the molecular formula C16H30N2O7S and a molecular weight of 394.49 g/mol. Its IUPAC name is N-[(1R)-1-[(4R,5S)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-nitroethyl]-2-methylpropane-2-sulfinamide.
| Compound Name | N-[(1R)-1-[(4R,5S)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-nitroethyl]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 132516912 |
| Molecular Formula | C16H30N2O7S |
| Molecular Weight | 394.49 g/mol |
| Exact Mass | 394.18 |
| IUPAC Name | N-[(1R)-1-[(4R,5S)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-nitroethyl]-2-methylpropane-2-sulfinamide |
| SMILES | CC1(C)O[C@H]([C@@H](C[N+](=O)[O-])NS(=O)C(C)(C)C)[C@@H]([C@H]2COC(C)(C)O2)O1 |
| InChI | InChI=1S/C16H30N2O7S/c1-14(2,3)26(21)17-10(8-18(19)20)12-13(25-16(6,7)24-12)11-9-22-15(4,5)23-11/h10-13,17H,8-9H2,1-7H3/t10-,11-,12-,13-,26?/m1/s1 |
| InChIKey | PEQTYUJYRMCKDL-UVEKMANPSA-N |
| XLogP | 1.36 |
| TPSA | 109.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.49 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|