C16H25NO6S — CID 10937265
(1R,3R)-1-[(4R,5R)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-3-(1,3-thiazol-2-yl)propane-1,3-diol (PubChem CID 10937265) has the molecular formula C16H25NO6S and a molecular weight of 359.44 g/mol. Its IUPAC name is (1R,3R)-1-[(4R,5R)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-3-(1,3-thiazol-2-yl)propane-1,3-diol.
| Compound Name | (1R,3R)-1-[(4R,5R)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-3-(1,3-thiazol-2-yl)propane-1,3-diol |
|---|---|
| PubChem CID | 10937265 |
| Molecular Formula | C16H25NO6S |
| Molecular Weight | 359.44 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | (1R,3R)-1-[(4R,5R)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-3-(1,3-thiazol-2-yl)propane-1,3-diol |
| SMILES | CC1(C)O[C@H]([C@H](O)C[C@@H](O)c2nccs2)[C@@H]([C@H]2COC(C)(C)O2)O1 |
| InChI | InChI=1S/C16H25NO6S/c1-15(2)20-8-11(21-15)13-12(22-16(3,4)23-13)9(18)7-10(19)14-17-5-6-24-14/h5-6,9-13,18-19H,7-8H2,1-4H3/t9-,10-,11-,12-,13-/m1/s1 |
| InChIKey | WBACENALRUEOJE-SYLRKERUSA-N |
| XLogP | 1.60 |
| TPSA | 90.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.44 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |