C19H26O5 — CID 100946832
(R)-[(4R,5R)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-(4-ethenylphenyl)methanol (PubChem CID 100946832) has the molecular formula C19H26O5 and a molecular weight of 334.41 g/mol. Its IUPAC name is (R)-[(4R,5R)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-(4-ethenylphenyl)methanol.
| Compound Name | (R)-[(4R,5R)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-(4-ethenylphenyl)methanol |
|---|---|
| PubChem CID | 100946832 |
| Molecular Formula | C19H26O5 |
| Molecular Weight | 334.41 g/mol |
| Exact Mass | 334.18 |
| IUPAC Name | (R)-[(4R,5R)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-(4-ethenylphenyl)methanol |
| SMILES | C=Cc1ccc([C@@H](O)[C@H]2OC(C)(C)O[C@@H]2[C@H]2COC(C)(C)O2)cc1 |
| InChI | InChI=1S/C19H26O5/c1-6-12-7-9-13(10-8-12)15(20)17-16(23-19(4,5)24-17)14-11-21-18(2,3)22-14/h6-10,14-17,20H,1,11H2,2-5H3/t14-,15-,16-,17-/m1/s1 |
| InChIKey | WOQOJLHKGIHYAW-QBPKDAKJSA-N |
| XLogP | 3.03 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.41 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |