C9H16O4 — CID 12039524
(1R)-1-[(3aR,4R,6aR)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]ethanol (PubChem CID 12039524) has the molecular formula C9H16O4 and a molecular weight of 188.22 g/mol. Its IUPAC name is (1R)-1-[(3aR,4R,6aR)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]ethanol.
| Compound Name | (1R)-1-[(3aR,4R,6aR)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]ethanol |
|---|---|
| PubChem CID | 12039524 |
| Molecular Formula | C9H16O4 |
| Molecular Weight | 188.22 g/mol |
| Exact Mass | 188.10 |
| IUPAC Name | (1R)-1-[(3aR,4R,6aR)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]ethanol |
| SMILES | C[C@@H](O)[C@H]1OC[C@H]2OC(C)(C)O[C@@H]12 |
| InChI | InChI=1S/C9H16O4/c1-5(10)7-8-6(4-11-7)12-9(2,3)13-8/h5-8,10H,4H2,1-3H3/t5-,6-,7-,8-/m1/s1 |
| InChIKey | GMQWSLKKKUZFGR-WCTZXXKLSA-N |
| XLogP | 0.29 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.22 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |