C11H19O3+ — CID 90830848
2,2-dimethyl-4-(2-methylpropyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole (PubChem CID 90830848) has the molecular formula C11H19O3+ and a molecular weight of 199.27 g/mol. Its IUPAC name is 2,2-dimethyl-4-(2-methylpropyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole.
| Compound Name | 2,2-dimethyl-4-(2-methylpropyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole |
|---|---|
| PubChem CID | 90830848 |
| Molecular Formula | C11H19O3+ |
| Molecular Weight | 199.27 g/mol |
| Exact Mass | 199.13 |
| IUPAC Name | 2,2-dimethyl-4-(2-methylpropyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole |
| SMILES | C[C+](C)CC1OCC2OC(C)(C)OC12 |
| InChI | InChI=1S/C11H19O3/c1-7(2)5-8-10-9(6-12-8)13-11(3,4)14-10/h8-10H,5-6H2,1-4H3/q+1 |
| InChIKey | QLLCCJPVEGUMOC-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.27 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|