C14H18O5S — CID 101180794
(3aR,4S,6aR)-4-(benzenesulfonylmethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole (PubChem CID 101180794) has the molecular formula C14H18O5S and a molecular weight of 298.36 g/mol. Its IUPAC name is (3aR,4S,6aR)-4-(benzenesulfonylmethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole.
| Compound Name | (3aR,4S,6aR)-4-(benzenesulfonylmethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole |
|---|---|
| PubChem CID | 101180794 |
| Molecular Formula | C14H18O5S |
| Molecular Weight | 298.36 g/mol |
| Exact Mass | 298.09 |
| IUPAC Name | (3aR,4S,6aR)-4-(benzenesulfonylmethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole |
| SMILES | CC1(C)O[C@H]2[C@@H](CS(=O)(=O)c3ccccc3)OC[C@H]2O1 |
| InChI | InChI=1S/C14H18O5S/c1-14(2)18-11-8-17-12(13(11)19-14)9-20(15,16)10-6-4-3-5-7-10/h3-7,11-13H,8-9H2,1-2H3/t11-,12-,13-/m1/s1 |
| InChIKey | JCXNCNAFNHBJCA-JHJVBQTASA-N |
| XLogP | 1.38 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.36 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |