C17H25NO5S — CID 10948244
(3aR,4R,5R,6R,6aS)-4-(benzenesulfonylmethyl)-6-ethyl-2,2,5-trimethyl-5-oxido-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-5-ium (PubChem CID 10948244) has the molecular formula C17H25NO5S and a molecular weight of 355.46 g/mol. Its IUPAC name is (3aR,4R,5R,6R,6aS)-4-(benzenesulfonylmethyl)-6-ethyl-2,2,5-trimethyl-5-oxido-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-5-ium.
| Compound Name | (3aR,4R,5R,6R,6aS)-4-(benzenesulfonylmethyl)-6-ethyl-2,2,5-trimethyl-5-oxido-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-5-ium |
|---|---|
| PubChem CID | 10948244 |
| Molecular Formula | C17H25NO5S |
| Molecular Weight | 355.46 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | (3aR,4R,5R,6R,6aS)-4-(benzenesulfonylmethyl)-6-ethyl-2,2,5-trimethyl-5-oxido-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-5-ium |
| SMILES | CC[C@@H]1[C@@H]2OC(C)(C)O[C@@H]2[C@H](CS(=O)(=O)c2ccccc2)[N@+]1(C)[O-] |
| InChI | InChI=1S/C17H25NO5S/c1-5-13-15-16(23-17(2,3)22-15)14(18(13,4)19)11-24(20,21)12-9-7-6-8-10-12/h6-10,13-16H,5,11H2,1-4H3/t13-,14+,15+,16-,18-/m1/s1 |
| InChIKey | YETGTJWQNIDWQZ-QYXWGXCQSA-N |
| XLogP | 2.09 |
| TPSA | 75.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.46 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|