C10H12O2S3 — CID 11021627
2-(benzenesulfonylmethyl)-1,3-dithiolane (PubChem CID 11021627) has the molecular formula C10H12O2S3 and a molecular weight of 260.40 g/mol. Its IUPAC name is 2-(benzenesulfonylmethyl)-1,3-dithiolane.
| Compound Name | 2-(benzenesulfonylmethyl)-1,3-dithiolane |
|---|---|
| PubChem CID | 11021627 |
| Molecular Formula | C10H12O2S3 |
| Molecular Weight | 260.40 g/mol |
| Exact Mass | 260.00 |
| IUPAC Name | 2-(benzenesulfonylmethyl)-1,3-dithiolane |
| SMILES | O=S(=O)(CC1SCCS1)c1ccccc1 |
| InChI | InChI=1S/C10H12O2S3/c11-15(12,8-10-13-6-7-14-10)9-4-2-1-3-5-9/h1-5,10H,6-8H2 |
| InChIKey | SOWBBKHNQNCFRK-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.40 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |