C14H18O2S3 — CID 58059258
3-(benzenesulfonylmethyl)-7-methylidene-1,5-dithiocane (PubChem CID 58059258) has the molecular formula C14H18O2S3 and a molecular weight of 314.50 g/mol. Its IUPAC name is 3-(benzenesulfonylmethyl)-7-methylidene-1,5-dithiocane.
| Compound Name | 3-(benzenesulfonylmethyl)-7-methylidene-1,5-dithiocane |
|---|---|
| PubChem CID | 58059258 |
| Molecular Formula | C14H18O2S3 |
| Molecular Weight | 314.50 g/mol |
| Exact Mass | 314.05 |
| IUPAC Name | 3-(benzenesulfonylmethyl)-7-methylidene-1,5-dithiocane |
| SMILES | C=C1CSCC(CS(=O)(=O)c2ccccc2)CSC1 |
| InChI | InChI=1S/C14H18O2S3/c1-12-7-17-9-13(10-18-8-12)11-19(15,16)14-5-3-2-4-6-14/h2-6,13H,1,7-11H2 |
| InChIKey | MKBCRQNEZUEXOR-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.50 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|