C16H17NO2S — CID 58241459
3-(benzenesulfonylmethyl)-1,2,3,4-tetrahydroquinoline (PubChem CID 58241459) has the molecular formula C16H17NO2S and a molecular weight of 287.38 g/mol. Its IUPAC name is 3-(benzenesulfonylmethyl)-1,2,3,4-tetrahydroquinoline.
| Compound Name | 3-(benzenesulfonylmethyl)-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 58241459 |
| Molecular Formula | C16H17NO2S |
| Molecular Weight | 287.38 g/mol |
| Exact Mass | 287.10 |
| IUPAC Name | 3-(benzenesulfonylmethyl)-1,2,3,4-tetrahydroquinoline |
| SMILES | O=S(=O)(CC1CNc2ccccc2C1)c1ccccc1 |
| InChI | InChI=1S/C16H17NO2S/c18-20(19,15-7-2-1-3-8-15)12-13-10-14-6-4-5-9-16(14)17-11-13/h1-9,13,17H,10-12H2 |
| InChIKey | VYXAVKYCMPATDH-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.38 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |