C12H17NO2 — CID 57137964
3-(methoxymethoxymethyl)-1,2,3,4-tetrahydroquinoline (PubChem CID 57137964) has the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. Its IUPAC name is 3-(methoxymethoxymethyl)-1,2,3,4-tetrahydroquinoline.
| Compound Name | 3-(methoxymethoxymethyl)-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 57137964 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | 3-(methoxymethoxymethyl)-1,2,3,4-tetrahydroquinoline |
| SMILES | COCOCC1CNc2ccccc2C1 |
| InChI | InChI=1S/C12H17NO2/c1-14-9-15-8-10-6-11-4-2-3-5-12(11)13-7-10/h2-5,10,13H,6-9H2,1H3 |
| InChIKey | PLRPAEJUFVQCQI-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|