C18H21NO — CID 106779338
3-[2-(4-methoxyphenyl)ethyl]-1,2,3,4-tetrahydroquinoline (PubChem CID 106779338) has the molecular formula C18H21NO and a molecular weight of 267.37 g/mol. Its IUPAC name is 3-[2-(4-methoxyphenyl)ethyl]-1,2,3,4-tetrahydroquinoline.
| Compound Name | 3-[2-(4-methoxyphenyl)ethyl]-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 106779338 |
| Molecular Formula | C18H21NO |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | 3-[2-(4-methoxyphenyl)ethyl]-1,2,3,4-tetrahydroquinoline |
| SMILES | COc1ccc(CCC2CNc3ccccc3C2)cc1 |
| InChI | InChI=1S/C18H21NO/c1-20-17-10-8-14(9-11-17)6-7-15-12-16-4-2-3-5-18(16)19-13-15/h2-5,8-11,15,19H,6-7,12-13H2,1H3 |
| InChIKey | KVOZUSOWLLITSM-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |