C13H18N2 — CID 105454799
3-(azetidin-1-ylmethyl)-1,2,3,4-tetrahydroquinoline (PubChem CID 105454799) has the molecular formula C13H18N2 and a molecular weight of 202.30 g/mol. Its IUPAC name is 3-(azetidin-1-ylmethyl)-1,2,3,4-tetrahydroquinoline.
| Compound Name | 3-(azetidin-1-ylmethyl)-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 105454799 |
| Molecular Formula | C13H18N2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.15 |
| IUPAC Name | 3-(azetidin-1-ylmethyl)-1,2,3,4-tetrahydroquinoline |
| SMILES | c1ccc2c(c1)CC(CN1CCC1)CN2 |
| InChI | InChI=1S/C13H18N2/c1-2-5-13-12(4-1)8-11(9-14-13)10-15-6-3-7-15/h1-2,4-5,11,14H,3,6-10H2 |
| InChIKey | GYYPQUIWWAAEPI-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |