C8H14N3O3+ — CID 6332686
(2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl)methylimino-iminoazanium (PubChem CID 6332686) has the molecular formula C8H14N3O3+ and a molecular weight of 200.22 g/mol. Its IUPAC name is (2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl)methylimino-iminoazanium.
| Compound Name | (2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl)methylimino-iminoazanium |
|---|---|
| PubChem CID | 6332686 |
| Molecular Formula | C8H14N3O3+ |
| Molecular Weight | 200.22 g/mol |
| Exact Mass | 200.10 |
| IUPAC Name | (2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl)methylimino-iminoazanium |
| SMILES | CC1(C)OC2COC(CN=[N+]=N)C2O1 |
| InChI | InChI=1S/C8H14N3O3/c1-8(2)13-6-4-12-5(3-10-11-9)7(6)14-8/h5-7,9H,3-4H2,1-2H3/q+1 |
| InChIKey | ISRSZIPCLNBXLJ-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 78.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.22 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|