C11H17IO5 — CID 126487744
(1R,2S,6S,9R)-4-(iodomethyl)-4,11,11-trimethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane (PubChem CID 126487744) has the molecular formula C11H17IO5 and a molecular weight of 356.16 g/mol. Its IUPAC name is (1R,2S,6S,9R)-4-(iodomethyl)-4,11,11-trimethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane.
| Compound Name | (1R,2S,6S,9R)-4-(iodomethyl)-4,11,11-trimethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane |
|---|---|
| PubChem CID | 126487744 |
| Molecular Formula | C11H17IO5 |
| Molecular Weight | 356.16 g/mol |
| Exact Mass | 356.01 |
| IUPAC Name | (1R,2S,6S,9R)-4-(iodomethyl)-4,11,11-trimethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane |
| SMILES | CC1(C)O[C@H]2[C@@H]3OC(C)(CI)O[C@@H]3OC[C@H]2O1 |
| InChI | InChI=1S/C11H17IO5/c1-10(2)14-6-4-13-9-8(7(6)15-10)16-11(3,5-12)17-9/h6-9H,4-5H2,1-3H3/t6-,7-,8+,9+,11?/m1/s1 |
| InChIKey | HERKAUPATOGRIE-MGFGZQEKSA-N |
| XLogP | 1.43 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.16 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|