C12H22O5Si — CID 91696465
(4,4-dimethyl-3,5,10,11-tetraoxatricyclo[6.2.1.02,6]undecan-7-yl)oxy-trimethylsilane (PubChem CID 91696465) has the molecular formula C12H22O5Si and a molecular weight of 274.39 g/mol. Its IUPAC name is (4,4-dimethyl-3,5,10,11-tetraoxatricyclo[6.2.1.02,6]undecan-7-yl)oxy-trimethylsilane.
| Compound Name | (4,4-dimethyl-3,5,10,11-tetraoxatricyclo[6.2.1.02,6]undecan-7-yl)oxy-trimethylsilane |
|---|---|
| PubChem CID | 91696465 |
| Molecular Formula | C12H22O5Si |
| Molecular Weight | 274.39 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | (4,4-dimethyl-3,5,10,11-tetraoxatricyclo[6.2.1.02,6]undecan-7-yl)oxy-trimethylsilane |
| SMILES | CC1(C)OC2C3OCC(O3)C(O[Si](C)(C)C)C2O1 |
| InChI | InChI=1S/C12H22O5Si/c1-12(2)15-9-8(17-18(3,4)5)7-6-13-11(14-7)10(9)16-12/h7-11H,6H2,1-5H3 |
| InChIKey | GRMXOTBMTGNDCA-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.39 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|