C25H41NO11 — CID 71748911
4-[[1-[[(1R,6R,7R)-4,4-dimethyl-3,5,10,11-tetraoxatricyclo[6.2.1.02,6]undecan-7-yl]oxy]-3-[[(1S,6S,7S)-4,4-dimethyl-3,5,10,11-tetraoxatricyclo[6.2.1.02,6]undecan-7-yl]oxy]propan-2-yl]amino]butan-1-ol (PubChem CID 71748911) has the molecular formula C25H41NO11 and a molecular weight of 531.60 g/mol. Its IUPAC name is 4-[[1-[[(1R,6R,7R)-4,4-dimethyl-3,5,10,11-tetraoxatricyclo[6.2.1.02,6]undecan-7-yl]oxy]-3-[[(1S,6S,7S)-4,4-dimethyl-3,5,10,11-tetraoxatricyclo[6.2.1.02,6]undecan-7-yl]oxy]propan-2-yl]amino]butan-1-ol.
| Compound Name | 4-[[1-[[(1R,6R,7R)-4,4-dimethyl-3,5,10,11-tetraoxatricyclo[6.2.1.02,6]undecan-7-yl]oxy]-3-[[(1S,6S,7S)-4,4-dimethyl-3,5,10,11-tetraoxatricyclo[6.2.1.02,6]undecan-7-yl]oxy]propan-2-yl]amino]butan-1-ol |
|---|---|
| PubChem CID | 71748911 |
| Molecular Formula | C25H41NO11 |
| Molecular Weight | 531.60 g/mol |
| Exact Mass | 531.27 |
| IUPAC Name | 4-[[1-[[(1R,6R,7R)-4,4-dimethyl-3,5,10,11-tetraoxatricyclo[6.2.1.02,6]undecan-7-yl]oxy]-3-[[(1S,6S,7S)-4,4-dimethyl-3,5,10,11-tetraoxatricyclo[6.2.1.02,6]undecan-7-yl]oxy]propan-2-yl]amino]butan-1-ol |
| SMILES | CC1(C)OC2[C@H]3OCC(O3)[C@H](OCC(CO[C@@H]3C4CO[C@H](O4)C4OC(C)(C)O[C@@H]43)NCCCCO)[C@@H]2O1 |
| InChI | InChI=1S/C25H41NO11/c1-24(2)34-18-16(14-11-30-22(32-14)20(18)36-24)28-9-13(26-7-5-6-8-27)10-29-17-15-12-31-23(33-15)21-19(17)35-25(3,4)37-21/h13-23,26-27H,5-12H2,1-4H3/t13?,14?,15?,16-,17+,18-,19+,20?,21?,22-,23+ |
| InChIKey | SNSVSWBVHRUWFW-UXDAAUNGSA-N |
| XLogP | 0.04 |
| TPSA | 124.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.60 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|