C21H39NO6 — CID 11165532
(3S)-3-(heptylamino)-3-[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]propan-1-ol (PubChem CID 11165532) has the molecular formula C21H39NO6 and a molecular weight of 401.54 g/mol. Its IUPAC name is (3S)-3-(heptylamino)-3-[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]propan-1-ol.
| Compound Name | (3S)-3-(heptylamino)-3-[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]propan-1-ol |
|---|---|
| PubChem CID | 11165532 |
| Molecular Formula | C21H39NO6 |
| Molecular Weight | 401.54 g/mol |
| Exact Mass | 401.28 |
| IUPAC Name | (3S)-3-(heptylamino)-3-[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]propan-1-ol |
| SMILES | CCCCCCCN[C@@H](CCO)[C@H]1O[C@@H]2OC(C)(C)O[C@@H]2[C@H]2OC(C)(C)O[C@H]21 |
| InChI | InChI=1S/C21H39NO6/c1-6-7-8-9-10-12-22-14(11-13-23)15-16-17(26-20(2,3)25-16)18-19(24-15)28-21(4,5)27-18/h14-19,22-23H,6-13H2,1-5H3/t14-,15+,16-,17-,18+,19+/m0/s1 |
| InChIKey | DJIJQPFMSNTILG-XNIJUTNWSA-N |
| XLogP | 2.69 |
| TPSA | 78.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.54 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|