C35H59NO5 — CID 11455912
(3S)-3-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-3-[[(Z)-octadec-9-enyl]amino]propan-1-ol (PubChem CID 11455912) has the molecular formula C35H59NO5 and a molecular weight of 573.86 g/mol. Its IUPAC name is (3S)-3-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-3-[[(Z)-octadec-9-enyl]amino]propan-1-ol.
| Compound Name | (3S)-3-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-3-[[(Z)-octadec-9-enyl]amino]propan-1-ol |
|---|---|
| PubChem CID | 11455912 |
| Molecular Formula | C35H59NO5 |
| Molecular Weight | 573.86 g/mol |
| Exact Mass | 573.44 |
| IUPAC Name | (3S)-3-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-3-[[(Z)-octadec-9-enyl]amino]propan-1-ol |
| SMILES | CCCCCCCC/C=C\CCCCCCCCN[C@@H](CCO)[C@H]1O[C@@H]2OC(C)(C)O[C@@H]2[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C35H59NO5/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-22-26-36-30(25-27-37)31-32(38-28-29-23-20-19-21-24-29)33-34(39-31)41-35(2,3)40-33/h11-12,19-21,23-24,30-34,36-37H,4-10,13-18,22,25-28H2,1-3H3/b12-11-/t30-,31+,32-,33+,34+/m0/s1 |
| InChIKey | YOKLAVKMGXOLSX-JUUKDATCSA-N |
| XLogP | 7.83 |
| TPSA | 69.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.86 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|