C20H29NO5 — CID 11187617
(3S)-3-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-3-(cyclopropylamino)propan-1-ol (PubChem CID 11187617) has the molecular formula C20H29NO5 and a molecular weight of 363.45 g/mol. Its IUPAC name is (3S)-3-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-3-(cyclopropylamino)propan-1-ol.
| Compound Name | (3S)-3-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-3-(cyclopropylamino)propan-1-ol |
|---|---|
| PubChem CID | 11187617 |
| Molecular Formula | C20H29NO5 |
| Molecular Weight | 363.45 g/mol |
| Exact Mass | 363.20 |
| IUPAC Name | (3S)-3-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-3-(cyclopropylamino)propan-1-ol |
| SMILES | CC1(C)O[C@H]2O[C@H]([C@H](CCO)NC3CC3)[C@H](OCc3ccccc3)[C@H]2O1 |
| InChI | InChI=1S/C20H29NO5/c1-20(2)25-18-17(23-12-13-6-4-3-5-7-13)16(24-19(18)26-20)15(10-11-22)21-14-8-9-14/h3-7,14-19,21-22H,8-12H2,1-2H3/t15-,16+,17-,18+,19+/m0/s1 |
| InChIKey | NWRHUQGHGDJWNI-ZWJWXYIHSA-N |
| XLogP | 1.95 |
| TPSA | 69.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.45 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |