C20H30O7Si — CID 101084288
(3R)-3-[(3aR,5R,6R,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2,3-dihydroxy-1-trimethylsilylpropan-1-one (PubChem CID 101084288) has the molecular formula C20H30O7Si and a molecular weight of 410.54 g/mol. Its IUPAC name is (3R)-3-[(3aR,5R,6R,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2,3-dihydroxy-1-trimethylsilylpropan-1-one.
| Compound Name | (3R)-3-[(3aR,5R,6R,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2,3-dihydroxy-1-trimethylsilylpropan-1-one |
|---|---|
| PubChem CID | 101084288 |
| Molecular Formula | C20H30O7Si |
| Molecular Weight | 410.54 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | (3R)-3-[(3aR,5R,6R,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2,3-dihydroxy-1-trimethylsilylpropan-1-one |
| SMILES | CC1(C)O[C@H]2O[C@H]([C@H](O)C(O)C(=O)[Si](C)(C)C)[C@@H](OCc3ccccc3)[C@H]2O1 |
| InChI | InChI=1S/C20H30O7Si/c1-20(2)26-17-16(24-11-12-9-7-6-8-10-12)15(25-19(17)27-20)13(21)14(22)18(23)28(3,4)5/h6-10,13-17,19,21-22H,11H2,1-5H3/t13-,14?,15-,16-,17-,19-/m1/s1 |
| InChIKey | QYLUFDMHNWPDCW-QQROGUGXSA-N |
| XLogP | 1.62 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.54 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|