C24H32O5Si — CID 164671259
(1R)-1-[(3aR,5R)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-[dimethyl(phenyl)silyl]ethanol (PubChem CID 164671259) has the molecular formula C24H32O5Si and a molecular weight of 428.60 g/mol. Its IUPAC name is (1R)-1-[(3aR,5R)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-[dimethyl(phenyl)silyl]ethanol.
| Compound Name | (1R)-1-[(3aR,5R)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-[dimethyl(phenyl)silyl]ethanol |
|---|---|
| PubChem CID | 164671259 |
| Molecular Formula | C24H32O5Si |
| Molecular Weight | 428.60 g/mol |
| Exact Mass | 428.20 |
| IUPAC Name | (1R)-1-[(3aR,5R)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-[dimethyl(phenyl)silyl]ethanol |
| SMILES | CC1(C)OC2C(OCc3ccccc3)[C@@H]([C@@H](O)C[Si](C)(C)c3ccccc3)O[C@@H]2O1 |
| InChI | InChI=1S/C24H32O5Si/c1-24(2)28-22-21(26-15-17-11-7-5-8-12-17)20(27-23(22)29-24)19(25)16-30(3,4)18-13-9-6-10-14-18/h5-14,19-23,25H,15-16H2,1-4H3/t19-,20+,21?,22?,23+/m0/s1 |
| InChIKey | ZXQLVEZAHVRBIT-HHHFKQEJSA-N |
| XLogP | 3.42 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.60 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|