C22H25ClO5S — CID 72713911
(1S)-1-[(3aR,5R,6R,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-(4-chlorophenyl)sulfanylethanol (PubChem CID 72713911) has the molecular formula C22H25ClO5S and a molecular weight of 436.96 g/mol. Its IUPAC name is (1S)-1-[(3aR,5R,6R,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-(4-chlorophenyl)sulfanylethanol.
| Compound Name | (1S)-1-[(3aR,5R,6R,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-(4-chlorophenyl)sulfanylethanol |
|---|---|
| PubChem CID | 72713911 |
| Molecular Formula | C22H25ClO5S |
| Molecular Weight | 436.96 g/mol |
| Exact Mass | 436.11 |
| IUPAC Name | (1S)-1-[(3aR,5R,6R,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-(4-chlorophenyl)sulfanylethanol |
| SMILES | CC1(C)O[C@H]2O[C@H]([C@H](O)CSc3ccc(Cl)cc3)[C@@H](OCc3ccccc3)[C@H]2O1 |
| InChI | InChI=1S/C22H25ClO5S/c1-22(2)27-20-19(25-12-14-6-4-3-5-7-14)18(26-21(20)28-22)17(24)13-29-16-10-8-15(23)9-11-16/h3-11,17-21,24H,12-13H2,1-2H3/t17-,18-,19-,20-,21-/m1/s1 |
| InChIKey | WMPGCZKAQWMZKY-PFAUGDHASA-N |
| XLogP | 4.25 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.96 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |