C17H23ClO5 — CID 13454063
(1R)-1-[(3aR,5R,6S,6aR)-6-[(2-chlorophenyl)methoxy]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]propan-1-ol (PubChem CID 13454063) has the molecular formula C17H23ClO5 and a molecular weight of 342.82 g/mol. Its IUPAC name is (1R)-1-[(3aR,5R,6S,6aR)-6-[(2-chlorophenyl)methoxy]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]propan-1-ol.
| Compound Name | (1R)-1-[(3aR,5R,6S,6aR)-6-[(2-chlorophenyl)methoxy]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]propan-1-ol |
|---|---|
| PubChem CID | 13454063 |
| Molecular Formula | C17H23ClO5 |
| Molecular Weight | 342.82 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | (1R)-1-[(3aR,5R,6S,6aR)-6-[(2-chlorophenyl)methoxy]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]propan-1-ol |
| SMILES | CC[C@@H](O)[C@H]1O[C@@H]2OC(C)(C)O[C@@H]2[C@H]1OCc1ccccc1Cl |
| InChI | InChI=1S/C17H23ClO5/c1-4-12(19)13-14(15-16(21-13)23-17(2,3)22-15)20-9-10-7-5-6-8-11(10)18/h5-8,12-16,19H,4,9H2,1-3H3/t12-,13-,14+,15-,16-/m1/s1 |
| InChIKey | FRKDUPCBYBJKMT-IBEHDNSVSA-N |
| XLogP | 2.87 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.82 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |