C17H24O6 — CID 54097873
(1R)-1-[(3aR,5R,6S,6aR)-6-[(2-methoxyphenyl)methoxy]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]ethanol (PubChem CID 54097873) has the molecular formula C17H24O6 and a molecular weight of 324.37 g/mol. Its IUPAC name is (1R)-1-[(3aR,5R,6S,6aR)-6-[(2-methoxyphenyl)methoxy]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]ethanol.
| Compound Name | (1R)-1-[(3aR,5R,6S,6aR)-6-[(2-methoxyphenyl)methoxy]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]ethanol |
|---|---|
| PubChem CID | 54097873 |
| Molecular Formula | C17H24O6 |
| Molecular Weight | 324.37 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | (1R)-1-[(3aR,5R,6S,6aR)-6-[(2-methoxyphenyl)methoxy]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]ethanol |
| SMILES | COc1ccccc1CO[C@@H]1[C@H]2OC(C)(C)O[C@H]2O[C@@H]1[C@@H](C)O |
| InChI | InChI=1S/C17H24O6/c1-10(18)13-14(15-16(21-13)23-17(2,3)22-15)20-9-11-7-5-6-8-12(11)19-4/h5-8,10,13-16,18H,9H2,1-4H3/t10-,13-,14+,15-,16-/m1/s1 |
| InChIKey | MYKWZGSBEDJRDR-LMXXTMHSSA-N |
| XLogP | 1.84 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.37 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |