C18H25ClO4 — CID 22825519
(3aR,5R,6S,6aR)-6-[(2-chlorophenyl)methoxy]-2,2-dimethyl-5-(2-methylpropyl)-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole (PubChem CID 22825519) has the molecular formula C18H25ClO4 and a molecular weight of 340.85 g/mol. Its IUPAC name is (3aR,5R,6S,6aR)-6-[(2-chlorophenyl)methoxy]-2,2-dimethyl-5-(2-methylpropyl)-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole.
| Compound Name | (3aR,5R,6S,6aR)-6-[(2-chlorophenyl)methoxy]-2,2-dimethyl-5-(2-methylpropyl)-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole |
|---|---|
| PubChem CID | 22825519 |
| Molecular Formula | C18H25ClO4 |
| Molecular Weight | 340.85 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | (3aR,5R,6S,6aR)-6-[(2-chlorophenyl)methoxy]-2,2-dimethyl-5-(2-methylpropyl)-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole |
| SMILES | CC(C)C[C@H]1O[C@@H]2OC(C)(C)O[C@@H]2[C@H]1OCc1ccccc1Cl |
| InChI | InChI=1S/C18H25ClO4/c1-11(2)9-14-15(16-17(21-14)23-18(3,4)22-16)20-10-12-7-5-6-8-13(12)19/h5-8,11,14-17H,9-10H2,1-4H3/t14-,15+,16-,17-/m1/s1 |
| InChIKey | PCHDUGMTYXMELV-YYIAUSFCSA-N |
| XLogP | 4.15 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.85 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |