C19H25ClO6 — CID 22825420
(3aR,5R,6S,6aR)-6-[(2-chlorophenyl)methoxy]-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole (PubChem CID 22825420) has the molecular formula C19H25ClO6 and a molecular weight of 384.86 g/mol. Its IUPAC name is (3aR,5R,6S,6aR)-6-[(2-chlorophenyl)methoxy]-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole.
| Compound Name | (3aR,5R,6S,6aR)-6-[(2-chlorophenyl)methoxy]-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole |
|---|---|
| PubChem CID | 22825420 |
| Molecular Formula | C19H25ClO6 |
| Molecular Weight | 384.86 g/mol |
| Exact Mass | 384.13 |
| IUPAC Name | (3aR,5R,6S,6aR)-6-[(2-chlorophenyl)methoxy]-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole |
| SMILES | CC1(C)O[C@H]2O[C@H]([C@H]3COC(C)(C)O3)[C@H](OCc3ccccc3Cl)[C@H]2O1 |
| InChI | InChI=1S/C19H25ClO6/c1-18(2)22-10-13(24-18)14-15(16-17(23-14)26-19(3,4)25-16)21-9-11-7-5-6-8-12(11)20/h5-8,13-17H,9-10H2,1-4H3/t13-,14-,15+,16-,17-/m1/s1 |
| InChIKey | QTVLZJDWNFVMOA-NQNKBUKLSA-N |
| XLogP | 3.25 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.86 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |