C17H21ClO5 — CID 13454068
1-[(3aR,5S,6R,6aR)-6-[(2-chlorophenyl)methoxy]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]propan-1-one (PubChem CID 13454068) has the molecular formula C17H21ClO5 and a molecular weight of 340.80 g/mol. Its IUPAC name is 1-[(3aR,5S,6R,6aR)-6-[(2-chlorophenyl)methoxy]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]propan-1-one.
| Compound Name | 1-[(3aR,5S,6R,6aR)-6-[(2-chlorophenyl)methoxy]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]propan-1-one |
|---|---|
| PubChem CID | 13454068 |
| Molecular Formula | C17H21ClO5 |
| Molecular Weight | 340.80 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | 1-[(3aR,5S,6R,6aR)-6-[(2-chlorophenyl)methoxy]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]propan-1-one |
| SMILES | CCC(=O)[C@H]1O[C@@H]2OC(C)(C)O[C@@H]2[C@H]1OCc1ccccc1Cl |
| InChI | InChI=1S/C17H21ClO5/c1-4-12(19)13-14(15-16(21-13)23-17(2,3)22-15)20-9-10-7-5-6-8-11(10)18/h5-8,13-16H,4,9H2,1-3H3/t13-,14+,15-,16-/m1/s1 |
| InChIKey | YLBFWJKPUJPPKK-QKPAOTATSA-N |
| XLogP | 3.08 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.80 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |