C18H25ClO5 — CID 54267074
(1R)-1-[(3aR,5R,6S,6aR)-6-[(2-chloro-3,4-dimethylphenyl)methoxy]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]ethanol (PubChem CID 54267074) has the molecular formula C18H25ClO5 and a molecular weight of 356.85 g/mol. Its IUPAC name is (1R)-1-[(3aR,5R,6S,6aR)-6-[(2-chloro-3,4-dimethylphenyl)methoxy]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]ethanol.
| Compound Name | (1R)-1-[(3aR,5R,6S,6aR)-6-[(2-chloro-3,4-dimethylphenyl)methoxy]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]ethanol |
|---|---|
| PubChem CID | 54267074 |
| Molecular Formula | C18H25ClO5 |
| Molecular Weight | 356.85 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | (1R)-1-[(3aR,5R,6S,6aR)-6-[(2-chloro-3,4-dimethylphenyl)methoxy]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]ethanol |
| SMILES | Cc1ccc(CO[C@@H]2[C@H]3OC(C)(C)O[C@H]3O[C@@H]2[C@@H](C)O)c(Cl)c1C |
| InChI | InChI=1S/C18H25ClO5/c1-9-6-7-12(13(19)10(9)2)8-21-15-14(11(3)20)22-17-16(15)23-18(4,5)24-17/h6-7,11,14-17,20H,8H2,1-5H3/t11-,14-,15+,16-,17-/m1/s1 |
| InChIKey | RHNASEQAORRRIC-ZQOQDGPXSA-N |
| XLogP | 3.10 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.85 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |