C21H25ClO5 — CID 70479409
(1R)-1-[(3aR,5R,6S,6aR)-6-[(2-chloronaphthalen-1-yl)methoxy]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]propan-1-ol (PubChem CID 70479409) has the molecular formula C21H25ClO5 and a molecular weight of 392.88 g/mol. Its IUPAC name is (1R)-1-[(3aR,5R,6S,6aR)-6-[(2-chloronaphthalen-1-yl)methoxy]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]propan-1-ol.
| Compound Name | (1R)-1-[(3aR,5R,6S,6aR)-6-[(2-chloronaphthalen-1-yl)methoxy]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]propan-1-ol |
|---|---|
| PubChem CID | 70479409 |
| Molecular Formula | C21H25ClO5 |
| Molecular Weight | 392.88 g/mol |
| Exact Mass | 392.14 |
| IUPAC Name | (1R)-1-[(3aR,5R,6S,6aR)-6-[(2-chloronaphthalen-1-yl)methoxy]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]propan-1-ol |
| SMILES | CC[C@@H](O)[C@H]1O[C@@H]2OC(C)(C)O[C@@H]2[C@H]1OCc1c(Cl)ccc2ccccc12 |
| InChI | InChI=1S/C21H25ClO5/c1-4-16(23)17-18(19-20(25-17)27-21(2,3)26-19)24-11-14-13-8-6-5-7-12(13)9-10-15(14)22/h5-10,16-20,23H,4,11H2,1-3H3/t16-,17-,18+,19-,20-/m1/s1 |
| InChIKey | OIJZMIVHOWTVCM-OUUBHVDSSA-N |
| XLogP | 4.03 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.88 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |