C18H26O7 — CID 11877048
(1R)-1-[(3aS,5R,6S,6aS)-6-[(4-ethoxyphenyl)methoxy]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]ethane-1,2-diol (PubChem CID 11877048) has the molecular formula C18H26O7 and a molecular weight of 354.40 g/mol. Its IUPAC name is (1R)-1-[(3aS,5R,6S,6aS)-6-[(4-ethoxyphenyl)methoxy]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]ethane-1,2-diol.
| Compound Name | (1R)-1-[(3aS,5R,6S,6aS)-6-[(4-ethoxyphenyl)methoxy]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]ethane-1,2-diol |
|---|---|
| PubChem CID | 11877048 |
| Molecular Formula | C18H26O7 |
| Molecular Weight | 354.40 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | (1R)-1-[(3aS,5R,6S,6aS)-6-[(4-ethoxyphenyl)methoxy]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]ethane-1,2-diol |
| SMILES | CCOc1ccc(CO[C@@H]2[C@@H]3OC(C)(C)O[C@@H]3O[C@@H]2[C@H](O)CO)cc1 |
| InChI | InChI=1S/C18H26O7/c1-4-21-12-7-5-11(6-8-12)10-22-15-14(13(20)9-19)23-17-16(15)24-18(2,3)25-17/h5-8,13-17,19-20H,4,9-10H2,1-3H3/t13-,14-,15+,16+,17+/m1/s1 |
| InChIKey | WHHIIMRGPWDFLO-NRKLIOEPSA-N |
| XLogP | 1.20 |
| TPSA | 86.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.40 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |