C11H20O7 — CID 135041165
1-[(3aR,5R,6S,6aR)-6-(methoxymethoxy)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]ethane-1,2-diol (PubChem CID 135041165) has the molecular formula C11H20O7 and a molecular weight of 264.27 g/mol. Its IUPAC name is 1-[(3aR,5R,6S,6aR)-6-(methoxymethoxy)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]ethane-1,2-diol.
| Compound Name | 1-[(3aR,5R,6S,6aR)-6-(methoxymethoxy)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]ethane-1,2-diol |
|---|---|
| PubChem CID | 135041165 |
| Molecular Formula | C11H20O7 |
| Molecular Weight | 264.27 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | 1-[(3aR,5R,6S,6aR)-6-(methoxymethoxy)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]ethane-1,2-diol |
| SMILES | COCO[C@@H]1[C@H]2OC(C)(C)O[C@H]2O[C@@H]1C(O)CO |
| InChI | InChI=1S/C11H20O7/c1-11(2)17-9-8(15-5-14-3)7(6(13)4-12)16-10(9)18-11/h6-10,12-13H,4-5H2,1-3H3/t6?,7-,8+,9-,10-/m1/s1 |
| InChIKey | CMODJWMLRJYDAM-JNSGDMPLSA-N |
| XLogP | -0.79 |
| TPSA | 86.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.27 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|