C18H34N2O6 — CID 10317291
(1R)-1-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-[4-(4-methylpiperazin-1-yl)butoxy]-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]ethane-1,2-diol (PubChem CID 10317291) has the molecular formula C18H34N2O6 and a molecular weight of 374.48 g/mol. Its IUPAC name is (1R)-1-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-[4-(4-methylpiperazin-1-yl)butoxy]-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]ethane-1,2-diol.
| Compound Name | (1R)-1-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-[4-(4-methylpiperazin-1-yl)butoxy]-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]ethane-1,2-diol |
|---|---|
| PubChem CID | 10317291 |
| Molecular Formula | C18H34N2O6 |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.24 |
| IUPAC Name | (1R)-1-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-[4-(4-methylpiperazin-1-yl)butoxy]-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]ethane-1,2-diol |
| SMILES | CN1CCN(CCCCO[C@@H]2[C@H]3OC(C)(C)O[C@H]3O[C@@H]2[C@H](O)CO)CC1 |
| InChI | InChI=1S/C18H34N2O6/c1-18(2)25-16-15(14(13(22)12-21)24-17(16)26-18)23-11-5-4-6-20-9-7-19(3)8-10-20/h13-17,21-22H,4-12H2,1-3H3/t13-,14-,15+,16-,17-/m1/s1 |
| InChIKey | RZQMLTJCPZGGIX-NQNKBUKLSA-N |
| XLogP | -0.37 |
| TPSA | 83.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|