C18H24O6 — CID 101145767
(1R)-1-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-[(E)-3-phenylprop-2-enoxy]-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]ethane-1,2-diol (PubChem CID 101145767) has the molecular formula C18H24O6 and a molecular weight of 336.38 g/mol. Its IUPAC name is (1R)-1-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-[(E)-3-phenylprop-2-enoxy]-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]ethane-1,2-diol.
| Compound Name | (1R)-1-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-[(E)-3-phenylprop-2-enoxy]-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]ethane-1,2-diol |
|---|---|
| PubChem CID | 101145767 |
| Molecular Formula | C18H24O6 |
| Molecular Weight | 336.38 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | (1R)-1-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-[(E)-3-phenylprop-2-enoxy]-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]ethane-1,2-diol |
| SMILES | CC1(C)O[C@H]2O[C@H]([C@H](O)CO)[C@H](OC/C=C/c3ccccc3)[C@H]2O1 |
| InChI | InChI=1S/C18H24O6/c1-18(2)23-16-15(14(13(20)11-19)22-17(16)24-18)21-10-6-9-12-7-4-3-5-8-12/h3-9,13-17,19-20H,10-11H2,1-2H3/b9-6+/t13-,14-,15+,16-,17-/m1/s1 |
| InChIKey | NRIDPXGNKMWDJG-VULAKGIDSA-N |
| XLogP | 1.31 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.38 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |