C10H18O8S — CID 24903503
[(3aR,5R,6S,6aR)-5-[(1S)-1,2-dihydroxyethyl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] methanesulfonate (PubChem CID 24903503) has the molecular formula C10H18O8S and a molecular weight of 298.31 g/mol. Its IUPAC name is [(3aR,5R,6S,6aR)-5-[(1S)-1,2-dihydroxyethyl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] methanesulfonate.
| Compound Name | [(3aR,5R,6S,6aR)-5-[(1S)-1,2-dihydroxyethyl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] methanesulfonate |
|---|---|
| PubChem CID | 24903503 |
| Molecular Formula | C10H18O8S |
| Molecular Weight | 298.31 g/mol |
| Exact Mass | 298.07 |
| IUPAC Name | [(3aR,5R,6S,6aR)-5-[(1S)-1,2-dihydroxyethyl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] methanesulfonate |
| SMILES | CC1(C)O[C@H]2O[C@H]([C@@H](O)CO)[C@H](OS(C)(=O)=O)[C@H]2O1 |
| InChI | InChI=1S/C10H18O8S/c1-10(2)16-8-7(18-19(3,13)14)6(5(12)4-11)15-9(8)17-10/h5-9,11-12H,4H2,1-3H3/t5-,6+,7-,8+,9+/m0/s1 |
| InChIKey | ZKICNBBPPAKCRV-KVEIKIFDSA-N |
| XLogP | -1.44 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.31 |
| LogP ≤ 5 | -1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|