C10H17N3O7S — CID 4531301
[5-(2-azido-1-hydroxyethyl)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] methanesulfonate (PubChem CID 4531301) has the molecular formula C10H17N3O7S and a molecular weight of 323.33 g/mol. Its IUPAC name is [5-(2-azido-1-hydroxyethyl)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] methanesulfonate.
| Compound Name | [5-(2-azido-1-hydroxyethyl)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] methanesulfonate |
|---|---|
| PubChem CID | 4531301 |
| Molecular Formula | C10H17N3O7S |
| Molecular Weight | 323.33 g/mol |
| Exact Mass | 323.08 |
| IUPAC Name | [5-(2-azido-1-hydroxyethyl)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] methanesulfonate |
| SMILES | CC1(C)OC2OC(C(O)CN=[N+]=[N-])C(OS(C)(=O)=O)C2O1 |
| InChI | InChI=1S/C10H17N3O7S/c1-10(2)18-8-7(20-21(3,15)16)6(17-9(8)19-10)5(14)4-12-13-11/h5-9,14H,4H2,1-3H3 |
| InChIKey | WWRCWVGOKPRINQ-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 140.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.33 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|