C11H18O7S2 — CID 11709627
S-[[(3aR,5S,6S,6aR)-2,2-dimethyl-6-methylsulfonyloxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]methyl] ethanethioate (PubChem CID 11709627) has the molecular formula C11H18O7S2 and a molecular weight of 326.39 g/mol. Its IUPAC name is S-[[(3aR,5S,6S,6aR)-2,2-dimethyl-6-methylsulfonyloxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]methyl] ethanethioate.
| Compound Name | S-[[(3aR,5S,6S,6aR)-2,2-dimethyl-6-methylsulfonyloxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]methyl] ethanethioate |
|---|---|
| PubChem CID | 11709627 |
| Molecular Formula | C11H18O7S2 |
| Molecular Weight | 326.39 g/mol |
| Exact Mass | 326.05 |
| IUPAC Name | S-[[(3aR,5S,6S,6aR)-2,2-dimethyl-6-methylsulfonyloxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]methyl] ethanethioate |
| SMILES | CC(=O)SC[C@H]1O[C@@H]2OC(C)(C)O[C@@H]2[C@@H]1OS(C)(=O)=O |
| InChI | InChI=1S/C11H18O7S2/c1-6(12)19-5-7-8(18-20(4,13)14)9-10(15-7)17-11(2,3)16-9/h7-10H,5H2,1-4H3/t7-,8-,9-,10-/m1/s1 |
| InChIKey | KUXROJMHPMRBHJ-ZYUZMQFOSA-N |
| XLogP | 0.49 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.39 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|