C17H24O7S — CID 10044796
[(3aR,5R,6S,6aR)-2,2-dimethyl-5-(2-phenylmethoxyethyl)-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] methanesulfonate (PubChem CID 10044796) has the molecular formula C17H24O7S and a molecular weight of 372.44 g/mol. Its IUPAC name is [(3aR,5R,6S,6aR)-2,2-dimethyl-5-(2-phenylmethoxyethyl)-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] methanesulfonate.
| Compound Name | [(3aR,5R,6S,6aR)-2,2-dimethyl-5-(2-phenylmethoxyethyl)-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] methanesulfonate |
|---|---|
| PubChem CID | 10044796 |
| Molecular Formula | C17H24O7S |
| Molecular Weight | 372.44 g/mol |
| Exact Mass | 372.12 |
| IUPAC Name | [(3aR,5R,6S,6aR)-2,2-dimethyl-5-(2-phenylmethoxyethyl)-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] methanesulfonate |
| SMILES | CC1(C)O[C@H]2O[C@H](CCOCc3ccccc3)[C@H](OS(C)(=O)=O)[C@H]2O1 |
| InChI | InChI=1S/C17H24O7S/c1-17(2)22-15-14(24-25(3,18)19)13(21-16(15)23-17)9-10-20-11-12-7-5-4-6-8-12/h4-8,13-16H,9-11H2,1-3H3/t13-,14+,15-,16-/m1/s1 |
| InChIKey | IYJGOBIQKZBHHN-QKPAOTATSA-N |
| XLogP | 1.81 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.44 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|