C23H28O6 — CID 73096039
5-[(4-methoxyphenyl)methoxymethyl]-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole (PubChem CID 73096039) has the molecular formula C23H28O6 and a molecular weight of 400.47 g/mol. Its IUPAC name is 5-[(4-methoxyphenyl)methoxymethyl]-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole.
| Compound Name | 5-[(4-methoxyphenyl)methoxymethyl]-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole |
|---|---|
| PubChem CID | 73096039 |
| Molecular Formula | C23H28O6 |
| Molecular Weight | 400.47 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | 5-[(4-methoxyphenyl)methoxymethyl]-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole |
| SMILES | COc1ccc(COCC2OC3OC(C)(C)OC3C2OCc2ccccc2)cc1 |
| InChI | InChI=1S/C23H28O6/c1-23(2)28-21-20(26-14-16-7-5-4-6-8-16)19(27-22(21)29-23)15-25-13-17-9-11-18(24-3)12-10-17/h4-12,19-22H,13-15H2,1-3H3 |
| InChIKey | JOBMBWHOPGRMJC-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.47 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |