C20H28O7S — CID 11647262
[(E)-5-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]pent-4-enyl] methanesulfonate (PubChem CID 11647262) has the molecular formula C20H28O7S and a molecular weight of 412.50 g/mol. Its IUPAC name is [(E)-5-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]pent-4-enyl] methanesulfonate.
| Compound Name | [(E)-5-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]pent-4-enyl] methanesulfonate |
|---|---|
| PubChem CID | 11647262 |
| Molecular Formula | C20H28O7S |
| Molecular Weight | 412.50 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | [(E)-5-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]pent-4-enyl] methanesulfonate |
| SMILES | CC1(C)O[C@H]2O[C@H](/C=C/CCCOS(C)(=O)=O)[C@H](OCc3ccccc3)[C@H]2O1 |
| InChI | InChI=1S/C20H28O7S/c1-20(2)26-18-17(23-14-15-10-6-4-7-11-15)16(25-19(18)27-20)12-8-5-9-13-24-28(3,21)22/h4,6-8,10-12,16-19H,5,9,13-14H2,1-3H3/b12-8+/t16-,17+,18-,19-/m1/s1 |
| InChIKey | PUHUEBNKJDWZTQ-WKPCOLEPSA-N |
| XLogP | 2.76 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.50 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|