C22H25NO4 — CID 101471911
1-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-N-benzylmethanimine (PubChem CID 101471911) has the molecular formula C22H25NO4 and a molecular weight of 367.44 g/mol. Its IUPAC name is 1-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-N-benzylmethanimine.
| Compound Name | 1-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-N-benzylmethanimine |
|---|---|
| PubChem CID | 101471911 |
| Molecular Formula | C22H25NO4 |
| Molecular Weight | 367.44 g/mol |
| Exact Mass | 367.18 |
| IUPAC Name | 1-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-N-benzylmethanimine |
| SMILES | CC1(C)O[C@H]2O[C@H](/C=N/Cc3ccccc3)[C@H](OCc3ccccc3)[C@H]2O1 |
| InChI | InChI=1S/C22H25NO4/c1-22(2)26-20-19(24-15-17-11-7-4-8-12-17)18(25-21(20)27-22)14-23-13-16-9-5-3-6-10-16/h3-12,14,18-21H,13,15H2,1-2H3/b23-14+/t18-,19+,20-,21-/m1/s1 |
| InChIKey | MENDBRKIPCIOFV-STULKGGRSA-N |
| XLogP | 3.72 |
| TPSA | 49.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.44 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|