C21H31O8P — CID 25197343
[(Z)-3-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]prop-2-enyl] diethyl phosphate (PubChem CID 25197343) has the molecular formula C21H31O8P and a molecular weight of 442.45 g/mol. Its IUPAC name is [(Z)-3-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]prop-2-enyl] diethyl phosphate.
| Compound Name | [(Z)-3-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]prop-2-enyl] diethyl phosphate |
|---|---|
| PubChem CID | 25197343 |
| Molecular Formula | C21H31O8P |
| Molecular Weight | 442.45 g/mol |
| Exact Mass | 442.18 |
| IUPAC Name | [(Z)-3-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]prop-2-enyl] diethyl phosphate |
| SMILES | CCOP(=O)(OCC)OC/C=C\[C@H]1O[C@@H]2OC(C)(C)O[C@@H]2[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C21H31O8P/c1-5-24-30(22,25-6-2)26-14-10-13-17-18(23-15-16-11-8-7-9-12-16)19-20(27-17)29-21(3,4)28-19/h7-13,17-20H,5-6,14-15H2,1-4H3/b13-10-/t17-,18+,19-,20-/m1/s1 |
| InChIKey | OZGMNZJTYUOPHI-KTYSHKDFSA-N |
| XLogP | 4.20 |
| TPSA | 81.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.45 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|